CAS 13476-79-4 is the registry number for Copper(II) hexanoate, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
Copper bis(hexanoate) (CAS 13476-79-4) is a chemical compound with the molecular formula C12H22CuO4 and a molecular weight of 293.85 g/mol. IUPAC name: copper bis(hexanoate). InChIKey: SMNMOEIFYRALNM-UHFFFAOYSA-L.
| Molecular formula | C12H22CuO4 |
|---|---|
| Molecular weight | 293.85 g/mol |
| IUPAC name | copper bis(hexanoate) |
| InChIKey | SMNMOEIFYRALNM-UHFFFAOYSA-L |
| SMILES | CCCCCC(=O)[O-].CCCCCC(=O)[O-].[Cu+2] |
Computed by PubChem (NCBI)