CAS 134768-83-5 is the registry number for Ioversol Impurity 8. Offered by: Chemat Brand. Available pack sizes: on request.
3-N-(2,3-dihydroxypropyl)-5-[(2-hydroxyacetyl)amino]-2,4,6-triiodobenzene-1,3-dicarboxamide (CAS 134768-83-5) is a chemical compound with the molecular formula C13H14I3N3O6 and a molecular weight of 688.98 g/mol. IUPAC name: 3-N-(2,3-dihydroxypropyl)-5-[(2-hydroxyacetyl)amino]-2,4,6-triiodobenzene-1,3-dicarboxamide. InChIKey: QBHAZSHFSPMUQT-UHFFFAOYSA-N.
| Molecular formula | C13H14I3N3O6 |
|---|---|
| Molecular weight | 688.98 g/mol |
| IUPAC name | 3-N-(2,3-dihydroxypropyl)-5-[(2-hydroxyacetyl)amino]-2,4,6-triiodobenzene-1,3-dicarboxamide |
| InChIKey | QBHAZSHFSPMUQT-UHFFFAOYSA-N |
| SMILES | C(C(CO)O)NC(=O)C1=C(C(=C(C(=C1I)C(=O)N)I)NC(=O)CO)I |
Computed by PubChem (NCBI)