CAS 13477-39-9 appears in our catalog under these names: calcium bis(metaphosphate), Calcium Metaphosphate, Calcium phosphate (Ca(PO3)2), 98%, 98%. Offered by: GLPBio, TCI, Chemat. Available pack sizes: 100g, 500g, 25g, 1kg.
CAS 13477-39-9 identifies a chemical compound with the molecular formula CaO6P2 and a molecular weight of 198.02 g/mol. InChIKey: ROPDWRCJTIRLTR-UHFFFAOYSA-L.
| Molecular formula | CaO6P2 |
|---|---|
| Molecular weight | 198.02 g/mol |
| InChIKey | ROPDWRCJTIRLTR-UHFFFAOYSA-L |
| SMILES | [O-]P(=O)=O.[O-]P(=O)=O.[Ca+2] |
Computed by PubChem (NCBI)