CAS 1347702-48-0 is the registry number for 4,4''–Dibromo–4',5'–bis(4–bromophenyl)–1,1':2',1''–terphenyl. Offered by: GLPBio. Available pack sizes: 10g, 5g.
1,2,4,5-tetrakis(4-bromophenyl)benzene (CAS 1347702-48-0) is a chemical compound with the molecular formula C30H18Br4 and a molecular weight of 698.1 g/mol. IUPAC name: 1,2,4,5-tetrakis(4-bromophenyl)benzene. InChIKey: JYYMXSUAPIUIAG-UHFFFAOYSA-N.
| Molecular formula | C30H18Br4 |
|---|---|
| Molecular weight | 698.1 g/mol |
| IUPAC name | 1,2,4,5-tetrakis(4-bromophenyl)benzene |
| InChIKey | JYYMXSUAPIUIAG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=C(C=C2C3=CC=C(C=C3)Br)C4=CC=C(C=C4)Br)C5=CC=C(C=C5)Br)Br |
Computed by PubChem (NCBI)