CAS 1347750-76-8 appears in our catalog under these names: Cbz-n-amido-peg2-acid, 95%, Cbz-NH-PEG2-C2-acid, Cbz–NH–PEG2–C2–acid, Cbz-NH-PEG2-C2-acid, 99.96%, CBz-n-amido-peg2-acid, 97%, 97%. Offered by: Combi-blocks, TargetMol, GLPBio, MedChemExpress, Chemat. Available pack sizes: 1g, 250mg, 25mg, 50mg, 100mg, 100 mg, 5 g, 250 mg.
3-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]propanoic acid (CAS 1347750-76-8) is a chemical compound with the molecular formula C15H21NO6 and a molecular weight of 311.33 g/mol. IUPAC name: 3-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]propanoic acid. InChIKey: XOMNIRHPTPYIMF-UHFFFAOYSA-N.
| Molecular formula | C15H21NO6 |
|---|---|
| Molecular weight | 311.33 g/mol |
| IUPAC name | 3-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]propanoic acid |
| InChIKey | XOMNIRHPTPYIMF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)