CAS 1347750-78-0 appears in our catalog under these names: Boc–NH–PEG5–CH2CH2COOH, Boc-NH-PEG(5)-COOH, t-Boc-N-amido-PEG5-acid, Boc-NH-PEG5-CH2CH2COOH 97%, 5,8,11,14,17-Pentaoxa-2-azaeicosanedioic acid, 1-(1,1-dimethylethyl) ester, 97%, 97%. Offered by: GLPBio, Iris Biotech, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 1000mg, 5000mg, 100mg, 10g, 25g.
3-[2-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1347750-78-0) is a chemical compound with the molecular formula C18H35NO9 and a molecular weight of 409.5 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: RVYBVZICXVYKRD-UHFFFAOYSA-N.
| Molecular formula | C18H35NO9 |
|---|---|
| Molecular weight | 409.5 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | RVYBVZICXVYKRD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)