CAS 134779-19-4 is the registry number for Murrayamine C. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-(3,5-dimethyl-11H-pyrano[3,2-a]carbazol-3-yl)-2-methylpent-1-en-3-ol (CAS 134779-19-4) is a chemical compound with the molecular formula C23H25NO2 and a molecular weight of 347.4 g/mol. IUPAC name: 5-(3,5-dimethyl-11H-pyrano[3,2-a]carbazol-3-yl)-2-methylpent-1-en-3-ol. InChIKey: SMFCNLXOVHSDML-UHFFFAOYSA-N.
| Molecular formula | C23H25NO2 |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | 5-(3,5-dimethyl-11H-pyrano[3,2-a]carbazol-3-yl)-2-methylpent-1-en-3-ol |
| InChIKey | SMFCNLXOVHSDML-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C3=C1OC(C=C3)(C)CCC(C(=C)C)O)NC4=CC=CC=C42 |
Computed by PubChem (NCBI)