CAS 13478-93-8 is the registry number for Nickel dimethylglyoxime, 95%. Offered by: Combi-blocks. Available pack sizes: 2g, 50g, 10g.
Nickel(2+);bis((NE)-N-[(3E)-3-oxidoiminobutan-2-ylidene]hydroxylamine) (CAS 13478-93-8) is a chemical compound with the molecular formula C8H14N4NiO4 and a molecular weight of 288.91 g/mol. IUPAC name: nickel(2+);bis((NE)-N-[(3E)-3-oxidoiminobutan-2-ylidene]hydroxylamine). InChIKey: UNMGLSGVXHBBPH-BVHINDLDSA-L.
| Molecular formula | C8H14N4NiO4 |
|---|---|
| Molecular weight | 288.91 g/mol |
| IUPAC name | nickel(2+);bis((NE)-N-[(3E)-3-oxidoiminobutan-2-ylidene]hydroxylamine) |
| InChIKey | UNMGLSGVXHBBPH-BVHINDLDSA-L |
| SMILES | C/C(=N\O)/C(=N/[O-])/C.C/C(=N\O)/C(=N/[O-])/C.[Ni+2] |
Computed by PubChem (NCBI)