Products 1347921-60-1
CAS 1347921-60-1 is the registry number for Methyl 3-amino-5,7-dimethyladamantane-1-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl 3-amino-5,7-dimethyladamantane-1-carboxylate;hydrochloride (CAS 1347921-60-1) is a chemical compound with the molecular formula C14H24ClNO2 and a molecular weight of 273.80 g/mol. IUPAC name: methyl 3-amino-5,7-dimethyladamantane-1-carboxylate;hydrochloride. InChIKey: RFFZZIYXIUHLAJ-UHFFFAOYSA-N.
| Molecular formula | C14H24ClNO2 |
|---|---|
| Molecular weight | 273.80 g/mol |
| IUPAC name | methyl 3-amino-5,7-dimethyladamantane-1-carboxylate;hydrochloride |
| InChIKey | RFFZZIYXIUHLAJ-UHFFFAOYSA-N |
| SMILES | CC12CC3(CC(C1)(CC(C2)(C3)N)C(=O)OC)C.Cl |
Computed by PubChem (NCBI)