CAS 134818-67-0 is the registry number for Prothioconazole Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.
1-chloro-2-(1-chlorocyclopropyl)-3-(2-chlorophenyl)propan-2-ol (CAS 134818-67-0) is a chemical compound with the molecular formula C12H13Cl3O and a molecular weight of 279.6 g/mol. IUPAC name: 1-chloro-2-(1-chlorocyclopropyl)-3-(2-chlorophenyl)propan-2-ol. InChIKey: LGNKJFHEXZRYDM-UHFFFAOYSA-N.
| Molecular formula | C12H13Cl3O |
|---|---|
| Molecular weight | 279.6 g/mol |
| IUPAC name | 1-chloro-2-(1-chlorocyclopropyl)-3-(2-chlorophenyl)propan-2-ol |
| InChIKey | LGNKJFHEXZRYDM-UHFFFAOYSA-N |
| SMILES | C1CC1(C(CC2=CC=CC=C2Cl)(CCl)O)Cl |
Computed by PubChem (NCBI)