CAS 13482-24-1 is the registry number for 4-Hydroxy Cyclohexanone-d4. Offered by: Chemat Brand. Available pack sizes: on request.
3,3,5,5-tetradeuterio-4-hydroxycyclohexan-1-one (CAS 13482-24-1) is a chemical compound with the molecular formula C6H10O2 and a molecular weight of 118.17 g/mol. IUPAC name: 3,3,5,5-tetradeuterio-4-hydroxycyclohexan-1-one. InChIKey: BXBJZYXQHHPVGO-VEPVEJTGSA-N.
| Molecular formula | C6H10O2 |
|---|---|
| Molecular weight | 118.17 g/mol |
| IUPAC name | 3,3,5,5-tetradeuterio-4-hydroxycyclohexan-1-one |
| InChIKey | BXBJZYXQHHPVGO-VEPVEJTGSA-N |
| SMILES | [2H]C1(CC(=O)CC(C1O)([2H])[2H])[2H] |
Computed by PubChem (NCBI)