CAS 13484-57-6 appears in our catalog under these names: 5,6-Dichloropyrazine-2,3-diamine 95%, 5,6-DICHLOROPYRAZINE-2,3-DIAMINE, 97%. Offered by: Ambeed, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 5g.
5,6-dichloropyrazine-2,3-diamine (CAS 13484-57-6) is a chemical compound with the molecular formula C4H4Cl2N4 and a molecular weight of 179.00 g/mol. IUPAC name: 5,6-dichloropyrazine-2,3-diamine. InChIKey: AARIMSUCMQEYOO-UHFFFAOYSA-N.
| Molecular formula | C4H4Cl2N4 |
|---|---|
| Molecular weight | 179.00 g/mol |
| IUPAC name | 5,6-dichloropyrazine-2,3-diamine |
| InChIKey | AARIMSUCMQEYOO-UHFFFAOYSA-N |
| SMILES | C1(=C(N=C(C(=N1)Cl)Cl)N)N |
Computed by PubChem (NCBI)