CAS 13484-67-8 is the registry number for Kinetin riboside-5'-monophosphate sodium salt. Offered by: Biosynth. Available pack sizes: 2mg, 1mg, 5mg, 10mg, 20mg.
[5-[6-(furan-2-ylmethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate (CAS 13484-67-8) is a chemical compound with the molecular formula C15H18N5O8P and a molecular weight of 427.31 g/mol. IUPAC name: [5-[6-(furan-2-ylmethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate. InChIKey: WDFCXEWULSQTFC-UHFFFAOYSA-N.
| Molecular formula | C15H18N5O8P |
|---|---|
| Molecular weight | 427.31 g/mol |
| IUPAC name | [5-[6-(furan-2-ylmethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| InChIKey | WDFCXEWULSQTFC-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)CNC2=C3C(=NC=N2)N(C=N3)C4C(C(C(O4)COP(=O)(O)O)O)O |
Computed by PubChem (NCBI)