Products 13487-42-8
CAS 13487-42-8 appears in our catalog under these names: cis-7,10,13,16-Docosatetraenoic Acid Methyl Ester, cis–7,10,13,16–Docosatetraenoic acid methyl ester, CIS-7,10,13,16-DOCOSATETRAENOIC ACID &, cis-7,10,13,16-Docosatetraenoic acid methyl ester, 99.9%. Offered by: TRC, GLPBio, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 100mg, 1g, 25MG, 5 mg, 10 mg, 25 mg.
Methyl (7E,10E,13E,16E)-docosa-7,10,13,16-tetraenoate (CAS 13487-42-8) is a chemical compound with the molecular formula C23H38O2 and a molecular weight of 346.5 g/mol. IUPAC name: methyl (7E,10E,13E,16E)-docosa-7,10,13,16-tetraenoate. InChIKey: ABGHYAFHPINIHF-SHDWVJIKSA-N.
| Molecular formula | C23H38O2 |
|---|---|
| Molecular weight | 346.5 g/mol |
| IUPAC name | methyl (7E,10E,13E,16E)-docosa-7,10,13,16-tetraenoate |
| InChIKey | ABGHYAFHPINIHF-SHDWVJIKSA-N |
| SMILES | CCCCC/C=C/C/C=C/C/C=C/C/C=C/CCCCCC(=O)OC |
Computed by PubChem (NCBI)