CAS 134877-43-3 appears in our catalog under these names: ((2R,3R,5R)-3-(Benzoyloxy)-4,4-difluoro-5-((methylsulfonyl)oxy)tetrahydrofuran-2-yl)methyl benzoate, 95%, Gemcitabine Impurity 2. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 100mg, 250mg, 1g, 5g, on request.
[(2R,3R,5S)-3-benzoyloxy-4,4-difluoro-5-methylsulfonyloxyoxolan-2-yl]methyl benzoate (CAS 134877-43-3) is a chemical compound with the molecular formula C20H18F2O8S and a molecular weight of 456.4 g/mol. IUPAC name: [(2R,3R,5S)-3-benzoyloxy-4,4-difluoro-5-methylsulfonyloxyoxolan-2-yl]methyl benzoate. InChIKey: LIAQHZDWFACWFK-MDZRGWNJSA-N.
| Molecular formula | C20H18F2O8S |
|---|---|
| Molecular weight | 456.4 g/mol |
| IUPAC name | [(2R,3R,5S)-3-benzoyloxy-4,4-difluoro-5-methylsulfonyloxyoxolan-2-yl]methyl benzoate |
| InChIKey | LIAQHZDWFACWFK-MDZRGWNJSA-N |
| SMILES | CS(=O)(=O)O[C@H]1C([C@@H]([C@H](O1)COC(=O)C2=CC=CC=C2)OC(=O)C3=CC=CC=C3)(F)F |
Computed by PubChem (NCBI)