CAS 13489-28-6 is the registry number for 6'-Methoxy-1-methyl-2',3',4',9'-tetrahydrospiro[piperidine-4,1'-pyrido[3,4-b]indole], 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-methoxy-1'-methylspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-piperidine] (CAS 13489-28-6) is a chemical compound with the molecular formula C17H23N3O and a molecular weight of 285.4 g/mol. IUPAC name: 6-methoxy-1'-methylspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-piperidine]. InChIKey: DMRKOSXILRSCJE-UHFFFAOYSA-N.
| Molecular formula | C17H23N3O |
|---|---|
| Molecular weight | 285.4 g/mol |
| IUPAC name | 6-methoxy-1'-methylspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-piperidine] |
| InChIKey | DMRKOSXILRSCJE-UHFFFAOYSA-N |
| SMILES | CN1CCC2(CC1)C3=C(CCN2)C4=C(N3)C=CC(=C4)OC |
Computed by PubChem (NCBI)