CAS 134892-18-5 appears in our catalog under these names: 2-(Dimethylaminocarbonyl)ethylboronic acid, pinacol ester, 98%, 2-(Dimethylaminocarbonyl)ethylboronic acid, pinacol ester. Offered by: Combi-blocks, Biosynth. Available pack sizes: 25g, 5g, 1g, 5000mg.
N,N-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanamide (CAS 134892-18-5) is a chemical compound with the molecular formula C11H22BNO3 and a molecular weight of 227.11 g/mol. IUPAC name: N,N-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanamide. InChIKey: XDDPXJJXCIJTGH-UHFFFAOYSA-N.
| Molecular formula | C11H22BNO3 |
|---|---|
| Molecular weight | 227.11 g/mol |
| IUPAC name | N,N-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanamide |
| InChIKey | XDDPXJJXCIJTGH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CCC(=O)N(C)C |
Computed by PubChem (NCBI)