CAS 13497-05-7 appears in our catalog under these names: Retinoic acid sodium salt, 95%, Sodium (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraenoate, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 100mg.
Sodium (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate (CAS 13497-05-7) is a chemical compound with the molecular formula C20H27NaO2 and a molecular weight of 322.4 g/mol. IUPAC name: sodium (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate. InChIKey: MLZFHHXDDHGSIR-ABAXVIISSA-M.
| Molecular formula | C20H27NaO2 |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | sodium (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
| InChIKey | MLZFHHXDDHGSIR-ABAXVIISSA-M |
| SMILES | CC1=C(C(CCC1)(C)C)/C=C/C(=C/C=C/C(=C/C(=O)[O-])/C)/C.[Na+] |
Computed by PubChem (NCBI)