CAS 13497-24-0 appears in our catalog under these names: Pentaethylene glycol dimethacrylate, 95%, Bis–methacrylate–PEG5, 2-Propenoic acid, 2-methyl-, 1,1'-(3,6,9,12-tetraoxatetradecane-1,14-diyl) ester, 95%, 95%, Bis-methacrylate-PEG5. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 50 mg, 25 mg, 100 mg, 10 mg.
2-[2-[2-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate (CAS 13497-24-0) is a chemical compound with the molecular formula C18H30O8 and a molecular weight of 374.4 g/mol. IUPAC name: 2-[2-[2-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate. InChIKey: HQKURBRFOOUSNI-UHFFFAOYSA-N.
| Molecular formula | C18H30O8 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate |
| InChIKey | HQKURBRFOOUSNI-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCCOCCOCCOCCOCCOC(=O)C(=C)C |
Computed by PubChem (NCBI)