CAS 1349716-03-5 appears in our catalog under these names: 5-Amino-2-(1-azepanyl)benzonitrile hydrochloride, 95%, 5-Amino-2-(azepan-1-yl)benzonitrile hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
5-amino-2-(azepan-1-yl)benzonitrile;hydrochloride (CAS 1349716-03-5) is a chemical compound with the molecular formula C13H18ClN3 and a molecular weight of 251.75 g/mol. IUPAC name: 5-amino-2-(azepan-1-yl)benzonitrile;hydrochloride. InChIKey: CKSOVKSGURQAEZ-UHFFFAOYSA-N.
| Molecular formula | C13H18ClN3 |
|---|---|
| Molecular weight | 251.75 g/mol |
| IUPAC name | 5-amino-2-(azepan-1-yl)benzonitrile;hydrochloride |
| InChIKey | CKSOVKSGURQAEZ-UHFFFAOYSA-N |
| SMILES | C1CCCN(CC1)C2=C(C=C(C=C2)N)C#N.Cl |
Computed by PubChem (NCBI)