Products 134984-98-8
CAS 134984-98-8 is the registry number for Furaquinocin C. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-hydroxy-7-methoxy-2,3,8-trimethyl-3-(4-methylpent-3-enyl)-2H-benzo[g][1]benzofuran-6,9-dione (CAS 134984-98-8) is a chemical compound with the molecular formula C22H26O5 and a molecular weight of 370.4 g/mol. IUPAC name: 4-hydroxy-7-methoxy-2,3,8-trimethyl-3-(4-methylpent-3-enyl)-2H-benzo[g][1]benzofuran-6,9-dione. InChIKey: GDSPWZDWUUGKIM-UHFFFAOYSA-N.
| Molecular formula | C22H26O5 |
|---|---|
| Molecular weight | 370.4 g/mol |
| IUPAC name | 4-hydroxy-7-methoxy-2,3,8-trimethyl-3-(4-methylpent-3-enyl)-2H-benzo[g][1]benzofuran-6,9-dione |
| InChIKey | GDSPWZDWUUGKIM-UHFFFAOYSA-N |
| SMILES | CC1C(C2=C(C=C3C(=C2O1)C(=O)C(=C(C3=O)OC)C)O)(C)CCC=C(C)C |
Computed by PubChem (NCBI)
Synonyms:
Furaquinocin C