CAS 1349980-81-9 is the registry number for (3Ar,4r,6as)-rel-octahydro-cyclopenta[c]pyrrol-4-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(3aR,4R,6aS)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-4-ol (CAS 1349980-81-9) is a chemical compound with the molecular formula C7H13NO and a molecular weight of 127.18 g/mol. IUPAC name: (3aR,4R,6aS)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-4-ol. InChIKey: ZOBDURRZNGBULZ-DSYKOEDSSA-N.
| Molecular formula | C7H13NO |
|---|---|
| Molecular weight | 127.18 g/mol |
| IUPAC name | (3aR,4R,6aS)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-4-ol |
| InChIKey | ZOBDURRZNGBULZ-DSYKOEDSSA-N |
| SMILES | C1C[C@H]([C@@H]2[C@H]1CNC2)O |
Computed by PubChem (NCBI)