CAS 135006-32-5 is the registry number for 1-(tert-Butyldiphenylsilyloxy)-3-butene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 400g.
But-3-enoxy-tert-butyl-diphenylsilane (CAS 135006-32-5) is a chemical compound with the molecular formula C20H26OSi and a molecular weight of 310.5 g/mol. IUPAC name: but-3-enoxy-tert-butyl-diphenylsilane. InChIKey: VKJSAFNFDZSGDF-UHFFFAOYSA-N.
| Molecular formula | C20H26OSi |
|---|---|
| Molecular weight | 310.5 g/mol |
| IUPAC name | but-3-enoxy-tert-butyl-diphenylsilane |
| InChIKey | VKJSAFNFDZSGDF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C1=CC=CC=C1)(C2=CC=CC=C2)OCCC=C |
Computed by PubChem (NCBI)