CAS 135018-15-4 appears in our catalog under these names: N-((2-Chloro-5-thiazolyl)methyl)-N’-nitroguanidine, >95% (HPLC), N-((2-Chloro-5-thiazolyl)methyl)-N'-nitroguanidine, >95% (HPLC), Clothianidin-desmethyl, Clothianidin-desmethyl, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: TRC, Dr. Ehrenstorfer, HPC Standards. Available pack sizes: 250mg, 500mg, 50mg, 10mg, 1x25mg, 1x1ml.
2-[(2-chloro-1,3-thiazol-5-yl)methyl]-1-nitroguanidine (CAS 135018-15-4) is a chemical compound with the molecular formula C5H6ClN5O2S and a molecular weight of 235.65 g/mol. IUPAC name: 2-[(2-chloro-1,3-thiazol-5-yl)methyl]-1-nitroguanidine. InChIKey: ZTLCLYBKONTDBT-UHFFFAOYSA-N.
| Molecular formula | C5H6ClN5O2S |
|---|---|
| Molecular weight | 235.65 g/mol |
| IUPAC name | 2-[(2-chloro-1,3-thiazol-5-yl)methyl]-1-nitroguanidine |
| InChIKey | ZTLCLYBKONTDBT-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=N1)Cl)CN=C(N)N[N+](=O)[O-] |
Computed by PubChem (NCBI)