CAS 1350374-40-1 is the registry number for 1-(4-Chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)ethan-1-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[4-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone (CAS 1350374-40-1) is a chemical compound with the molecular formula C14H18BClO3 and a molecular weight of 280.56 g/mol. IUPAC name: 1-[4-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone. InChIKey: UJIZNSOUTFQQHJ-UHFFFAOYSA-N.
| Molecular formula | C14H18BClO3 |
|---|---|
| Molecular weight | 280.56 g/mol |
| IUPAC name | 1-[4-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone |
| InChIKey | UJIZNSOUTFQQHJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)Cl)C(=O)C |
Computed by PubChem (NCBI)