Products 1350450-51-9

CAS 1350450-51-9 is the registry number for (S)-Fmoc-2-amino-heptanedioic acid, 98%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)heptanedioic acid (CAS 1350450-51-9) is a chemical compound with the molecular formula C22H23NO6 and a molecular weight of 397.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)heptanedioic acid. InChIKey: WNGQUSSMDLUWLH-IBGZPJMESA-N.

Identity
Molecular formulaC22H23NO6
Molecular weight397.4 g/mol
IUPAC name(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)heptanedioic acid
InChIKeyWNGQUSSMDLUWLH-IBGZPJMESA-N
SMILESC1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCCCC(=O)O)C(=O)O

Computed by PubChem (NCBI)