CAS 1350450-51-9 is the registry number for (S)-Fmoc-2-amino-heptanedioic acid, 98%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)heptanedioic acid (CAS 1350450-51-9) is a chemical compound with the molecular formula C22H23NO6 and a molecular weight of 397.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)heptanedioic acid. InChIKey: WNGQUSSMDLUWLH-IBGZPJMESA-N.
| Molecular formula | C22H23NO6 |
|---|---|
| Molecular weight | 397.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)heptanedioic acid |
| InChIKey | WNGQUSSMDLUWLH-IBGZPJMESA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCCCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)