CAS 1350636-75-7 is the registry number for tert-Butyl ((1R,3R,4R)-3-hydroxy-4-mercaptocyclohexyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(1R,3R,4R)-3-hydroxy-4-sulfanylcyclohexyl]carbamate (CAS 1350636-75-7) is a chemical compound with the molecular formula C11H21NO3S and a molecular weight of 247.36 g/mol. IUPAC name: tert-butyl N-[(1R,3R,4R)-3-hydroxy-4-sulfanylcyclohexyl]carbamate. InChIKey: JYIPIAAEFGAORO-IWSPIJDZSA-N.
| Molecular formula | C11H21NO3S |
|---|---|
| Molecular weight | 247.36 g/mol |
| IUPAC name | tert-butyl N-[(1R,3R,4R)-3-hydroxy-4-sulfanylcyclohexyl]carbamate |
| InChIKey | JYIPIAAEFGAORO-IWSPIJDZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC[C@H]([C@@H](C1)O)S |
Computed by PubChem (NCBI)