Products 1350648-40-6
CAS 1350648-40-6 appears in our catalog under these names: 3,5-Difluoro-4-iodo-pyridine-2-carbonitrile, 98%, 3,5-difluoro-4-iodopicolinonitrile, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 50mg, 250mg, 500mg, 1g, 5g, 10g, 25g.
3,5-difluoro-4-iodopyridine-2-carbonitrile (CAS 1350648-40-6) is a chemical compound with the molecular formula C6HF2IN2 and a molecular weight of 265.99 g/mol. IUPAC name: 3,5-difluoro-4-iodopyridine-2-carbonitrile. InChIKey: DIZQHKYVQVHNLH-UHFFFAOYSA-N.
| Molecular formula | C6HF2IN2 |
|---|---|
| Molecular weight | 265.99 g/mol |
| IUPAC name | 3,5-difluoro-4-iodopyridine-2-carbonitrile |
| InChIKey | DIZQHKYVQVHNLH-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)C#N)F)I)F |
Computed by PubChem (NCBI)