CAS 135072-61-6 is the registry number for Dimethylsily(t-butylarnido)(tetramethyl cyclopentadienyl)titanium dichloride, 98%,RG, 98%,RG. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
CAS 135072-61-6 identifies a chemical compound with the molecular formula C15H27Cl2NSiTi- and a molecular weight of 368.2 g/mol. InChIKey: OXQYDCCXYYUFSZ-UHFFFAOYSA-L.
| Molecular formula | C15H27Cl2NSiTi- |
|---|---|
| Molecular weight | 368.2 g/mol |
| InChIKey | OXQYDCCXYYUFSZ-UHFFFAOYSA-L |
| SMILES | CC1=C([C](C(=C1C)[Si](C)(C)[N-]C(C)(C)C)C)C.Cl[Ti]Cl |
Computed by PubChem (NCBI)