CAS 135072-62-7 is the registry number for [N-(1,1-Dimethylethyl)-1,1-dimethyl-1-[(1,2,3,4,5-η)-2,3,4,5-tetramethyl-2,4-cyclopentadien-1-yl]silanaminato(2-)-κN]dimethyltitanium, 99%, 99%. Offered by: Chemat. Available pack sizes: 5g, 25g.
Tris(2,3,4,5,6-pentafluorophenyl)borane (CAS 135072-62-7) is a chemical compound with the molecular formula C18BF15 and a molecular weight of 512.0 g/mol. IUPAC name: tris(2,3,4,5,6-pentafluorophenyl)borane. InChIKey: OBAJXDYVZBHCGT-UHFFFAOYSA-N.
| Molecular formula | C18BF15 |
|---|---|
| Molecular weight | 512.0 g/mol |
| IUPAC name | tris(2,3,4,5,6-pentafluorophenyl)borane |
| InChIKey | OBAJXDYVZBHCGT-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C(=C1F)F)F)F)F)(C2=C(C(=C(C(=C2F)F)F)F)F)C3=C(C(=C(C(=C3F)F)F)F)F |
Computed by PubChem (NCBI)