CAS 1350734-46-1 is the registry number for 2,2,2-trifluoro-N-[rel-(1R,3R,6S)-7-oxabicyclo[4.1.0]heptan-3-yl]acetamide, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
2,2,2-trifluoro-N-[(1R,3R,6S)-7-oxabicyclo[4.1.0]heptan-3-yl]acetamide (CAS 1350734-46-1) is a chemical compound with the molecular formula C8H10F3NO2 and a molecular weight of 209.17 g/mol. IUPAC name: 2,2,2-trifluoro-N-[(1R,3R,6S)-7-oxabicyclo[4.1.0]heptan-3-yl]acetamide. InChIKey: XPCYCHZBRGPEBW-NGJCXOISSA-N.
| Molecular formula | C8H10F3NO2 |
|---|---|
| Molecular weight | 209.17 g/mol |
| IUPAC name | 2,2,2-trifluoro-N-[(1R,3R,6S)-7-oxabicyclo[4.1.0]heptan-3-yl]acetamide |
| InChIKey | XPCYCHZBRGPEBW-NGJCXOISSA-N |
| SMILES | C1C[C@H]2[C@H](O2)C[C@@H]1NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)