CAS 135074-42-9 is the registry number for 5-(2-Bromo-1,1,2,2-tetrafluoroethyl)bicyclo[2.2.1]hept-2-ene, >95%, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g.
5-(2-bromo-1,1,2,2-tetrafluoroethyl)bicyclo[2.2.1]hept-2-ene (CAS 135074-42-9) is a chemical compound with the molecular formula C9H9BrF4 and a molecular weight of 273.06 g/mol. IUPAC name: 5-(2-bromo-1,1,2,2-tetrafluoroethyl)bicyclo[2.2.1]hept-2-ene. InChIKey: WKMWNGKKENFVDJ-UHFFFAOYSA-N.
| Molecular formula | C9H9BrF4 |
|---|---|
| Molecular weight | 273.06 g/mol |
| IUPAC name | 5-(2-bromo-1,1,2,2-tetrafluoroethyl)bicyclo[2.2.1]hept-2-ene |
| InChIKey | WKMWNGKKENFVDJ-UHFFFAOYSA-N |
| SMILES | C1C2CC(C1C=C2)C(C(F)(F)Br)(F)F |
Computed by PubChem (NCBI)