CAS 1350755-71-3 is the registry number for 5-(Tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine-2,3-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine-2,3-diamine (CAS 1350755-71-3) is a chemical compound with the molecular formula C10H17BN4O2 and a molecular weight of 236.08 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine-2,3-diamine. InChIKey: RXCMBGUWEUFTMY-UHFFFAOYSA-N.
| Molecular formula | C10H17BN4O2 |
|---|---|
| Molecular weight | 236.08 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine-2,3-diamine |
| InChIKey | RXCMBGUWEUFTMY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C(=N2)N)N |
Computed by PubChem (NCBI)