CAS 1350765-28-4 is the registry number for CCR2 ligand-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[4-chloro-2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]phenoxy]benzoic acid (CAS 1350765-28-4) is a chemical compound with the molecular formula C20H12Cl2F3NO5S and a molecular weight of 506.3 g/mol. IUPAC name: 4-[4-chloro-2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]phenoxy]benzoic acid. InChIKey: SANQVDRYJWOBEY-UHFFFAOYSA-N.
| Molecular formula | C20H12Cl2F3NO5S |
|---|---|
| Molecular weight | 506.3 g/mol |
| IUPAC name | 4-[4-chloro-2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]phenoxy]benzoic acid |
| InChIKey | SANQVDRYJWOBEY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)OC2=C(C=C(C=C2)Cl)NS(=O)(=O)C3=CC(=C(C=C3)Cl)C(F)(F)F |
Computed by PubChem (NCBI)