Products 1350767-15-5

CAS 1350767-15-5 is the registry number for 2,5-Di-tert-butyl-1,4-phenylene tetraethyl bis(phosphate), 95%. Offered by: Chemat Brand. Available pack sizes: on request.

(2,5-ditert-butyl-4-diethoxyphosphoryloxyphenyl) diethyl phosphate (CAS 1350767-15-5) is a chemical compound with the molecular formula C22H40O8P2 and a molecular weight of 494.5 g/mol. IUPAC name: (2,5-ditert-butyl-4-diethoxyphosphoryloxyphenyl) diethyl phosphate. InChIKey: MASHVQGHNWZVDK-UHFFFAOYSA-N.

Identity
Molecular formulaC22H40O8P2
Molecular weight494.5 g/mol
IUPAC name(2,5-ditert-butyl-4-diethoxyphosphoryloxyphenyl) diethyl phosphate
InChIKeyMASHVQGHNWZVDK-UHFFFAOYSA-N
SMILESCCOP(=O)(OCC)OC1=CC(=C(C=C1C(C)(C)C)OP(=O)(OCC)OCC)C(C)(C)C

Computed by PubChem (NCBI)