CAS 135077-31-5 is the registry number for 2-Ethyl-6-fluoro-1,4-dihydroquinolin-4-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-ethyl-6-fluoro-1H-quinolin-4-one (CAS 135077-31-5) is a chemical compound with the molecular formula C11H10FNO and a molecular weight of 191.20 g/mol. IUPAC name: 2-ethyl-6-fluoro-1H-quinolin-4-one. InChIKey: VHEVEYVRFMAFTR-UHFFFAOYSA-N.
| Molecular formula | C11H10FNO |
|---|---|
| Molecular weight | 191.20 g/mol |
| IUPAC name | 2-ethyl-6-fluoro-1H-quinolin-4-one |
| InChIKey | VHEVEYVRFMAFTR-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=O)C2=C(N1)C=CC(=C2)F |
Computed by PubChem (NCBI)