CAS 1350901-36-8 appears in our catalog under these names: Quintrione, Quintrione, >95% (HPLC). Offered by: Chemat Brand, Dr. Ehrenstorfer, TRC. Available pack sizes: on request, 10mg, 250mg, 500mg, 50mg.
2-(3,7-dichloroquinoline-8-carbonyl)cyclohexane-1,3-dione (CAS 1350901-36-8) is a chemical compound with the molecular formula C16H11Cl2NO3 and a molecular weight of 336.2 g/mol. IUPAC name: 2-(3,7-dichloroquinoline-8-carbonyl)cyclohexane-1,3-dione. InChIKey: SZPMWKUJLQEAEL-UHFFFAOYSA-N.
| Molecular formula | C16H11Cl2NO3 |
|---|---|
| Molecular weight | 336.2 g/mol |
| IUPAC name | 2-(3,7-dichloroquinoline-8-carbonyl)cyclohexane-1,3-dione |
| InChIKey | SZPMWKUJLQEAEL-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C(C(=O)C1)C(=O)C2=C(C=CC3=CC(=CN=C32)Cl)Cl |
Computed by PubChem (NCBI)