CAS 1350965-83-1 appears in our catalog under these names: CGS-12066A Maleate Salt, >95% (HPLC), 4–(4–Methylpiperazin–1–yl)–7–(trifluoromethyl)pyrrolo(1,2–a)quinoxaline maleate, CGS-12066 maleate 98%, CGS-12066 (maleate). Offered by: TRC, GLPBio, Ambeed, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g, 50 mg, 25 mg, 10 mg.
(Z)-but-2-enedioic acid;4-(4-methylpiperazin-1-yl)-7-(trifluoromethyl)pyrrolo[1,2-a]quinoxaline (CAS 1350965-83-1) is a chemical compound with the molecular formula C21H21F3N4O4 and a molecular weight of 450.4 g/mol. IUPAC name: (Z)-but-2-enedioic acid;4-(4-methylpiperazin-1-yl)-7-(trifluoromethyl)pyrrolo[1,2-a]quinoxaline. InChIKey: ZBPAHEUAJMCLRD-BTJKTKAUSA-N.
| Molecular formula | C21H21F3N4O4 |
|---|---|
| Molecular weight | 450.4 g/mol |
| IUPAC name | (Z)-but-2-enedioic acid;4-(4-methylpiperazin-1-yl)-7-(trifluoromethyl)pyrrolo[1,2-a]quinoxaline |
| InChIKey | ZBPAHEUAJMCLRD-BTJKTKAUSA-N |
| SMILES | CN1CCN(CC1)C2=NC3=C(C=CC(=C3)C(F)(F)F)N4C2=CC=C4.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)