CAS 1350988-83-8 is the registry number for 5-(1,3-Benzothiazol-2-yl)-1,3,4-oxadiazol-2-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-(1,3-benzothiazol-2-yl)-1,3,4-oxadiazol-2-amine (CAS 1350988-83-8) is a chemical compound with the molecular formula C9H6N4OS and a molecular weight of 218.24 g/mol. IUPAC name: 5-(1,3-benzothiazol-2-yl)-1,3,4-oxadiazol-2-amine. InChIKey: IBFZVUMZCVQSDP-UHFFFAOYSA-N.
| Molecular formula | C9H6N4OS |
|---|---|
| Molecular weight | 218.24 g/mol |
| IUPAC name | 5-(1,3-benzothiazol-2-yl)-1,3,4-oxadiazol-2-amine |
| InChIKey | IBFZVUMZCVQSDP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)C3=NN=C(O3)N |
Computed by PubChem (NCBI)