CAS 1351185-73-3 is the registry number for Enzalutamide Impurity 43. Offered by: Chemat Brand. Available pack sizes: on request.
4-[[4-cyano-3-(trifluoromethyl)phenyl]carbamoylamino]-2-fluoro-N-methylbenzamide (CAS 1351185-73-3) is a chemical compound with the molecular formula C17H12F4N4O2 and a molecular weight of 380.30 g/mol. IUPAC name: 4-[[4-cyano-3-(trifluoromethyl)phenyl]carbamoylamino]-2-fluoro-N-methylbenzamide. InChIKey: VEZULCRYQHRKCB-UHFFFAOYSA-N.
| Molecular formula | C17H12F4N4O2 |
|---|---|
| Molecular weight | 380.30 g/mol |
| IUPAC name | 4-[[4-cyano-3-(trifluoromethyl)phenyl]carbamoylamino]-2-fluoro-N-methylbenzamide |
| InChIKey | VEZULCRYQHRKCB-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=C(C=C(C=C1)NC(=O)NC2=CC(=C(C=C2)C#N)C(F)(F)F)F |
Computed by PubChem (NCBI)