CAS 1351344-23-4 is the registry number for rel-(3R,4S)-1-Benzyl-4-(2,4-difluoro-5-methylphenyl)pyrrolidin-3-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,4S)-1-benzyl-4-(2,4-difluoro-5-methylphenyl)pyrrolidin-3-amine (CAS 1351344-23-4) is a chemical compound with the molecular formula C18H20F2N2 and a molecular weight of 302.4 g/mol. IUPAC name: (3R,4S)-1-benzyl-4-(2,4-difluoro-5-methylphenyl)pyrrolidin-3-amine. InChIKey: PHLSUELFYUBZBJ-QAPCUYQASA-N.
| Molecular formula | C18H20F2N2 |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | (3R,4S)-1-benzyl-4-(2,4-difluoro-5-methylphenyl)pyrrolidin-3-amine |
| InChIKey | PHLSUELFYUBZBJ-QAPCUYQASA-N |
| SMILES | CC1=CC(=C(C=C1F)F)[C@H]2CN(C[C@@H]2N)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)