CAS 135145-90-3 appears in our catalog under these names: 2,5-Dichlorophenylboronic Acid, 2,5–Dichlorophenylboronic acid(contains varying amounts of Anhydride), 2,5-Dichlorobenzeneboronic acid, 98% , 2,5-Dichlorophenylboronic Acid (contains varying amounts of Anhydride), 2,5-Dichlorophenylboronic acid 98%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: 1g, 25g, 5g, 100g, 500g, 10g.
(2,5-dichlorophenyl)boronic acid (CAS 135145-90-3) is a chemical compound with the molecular formula C6H5BCl2O2 and a molecular weight of 190.82 g/mol. IUPAC name: (2,5-dichlorophenyl)boronic acid. InChIKey: NNTFPBXQPOQRBT-UHFFFAOYSA-N.
| Molecular formula | C6H5BCl2O2 |
|---|---|
| Molecular weight | 190.82 g/mol |
| IUPAC name | (2,5-dichlorophenyl)boronic acid |
| InChIKey | NNTFPBXQPOQRBT-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)Cl)Cl)(O)O |
Computed by PubChem (NCBI)