Products 1351478-13-1
CAS 1351478-13-1 is the registry number for 5-Bromo-3-iodo-2-methyl-1H-pyrrolo[2,3-b]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-3-iodo-2-methyl-1H-pyrrolo[2,3-b]pyridine (CAS 1351478-13-1) is a chemical compound with the molecular formula C8H6BrIN2 and a molecular weight of 336.95 g/mol. IUPAC name: 5-bromo-3-iodo-2-methyl-1H-pyrrolo[2,3-b]pyridine. InChIKey: CKGZOPNQTXOXRS-UHFFFAOYSA-N.
| Molecular formula | C8H6BrIN2 |
|---|---|
| Molecular weight | 336.95 g/mol |
| IUPAC name | 5-bromo-3-iodo-2-methyl-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | CKGZOPNQTXOXRS-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1)N=CC(=C2)Br)I |
Computed by PubChem (NCBI)