CAS 13515-40-7 appears in our catalog under these names: Pigment yellow 73, 98%, Pigment Yellow 73, 2-((4-Chloro-2-nitrophenyl)azo)-N-(2-methoxyphenyl)-3-oxobutanamide. Offered by: Combi-blocks, Dr. Ehrenstorfer, Biosynth, MedChemExpress. Available pack sizes: 1g, 100g, 25g, 5g, 25mg, 500g, 250g, 1000g.
2-[(4-chloro-2-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)-3-oxobutanamide (CAS 13515-40-7) is a chemical compound with the molecular formula C17H15ClN4O5 and a molecular weight of 390.8 g/mol. IUPAC name: 2-[(4-chloro-2-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)-3-oxobutanamide. InChIKey: QPHCXDDGQQLPIM-UHFFFAOYSA-N.
| Molecular formula | C17H15ClN4O5 |
|---|---|
| Molecular weight | 390.8 g/mol |
| IUPAC name | 2-[(4-chloro-2-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)-3-oxobutanamide |
| InChIKey | QPHCXDDGQQLPIM-UHFFFAOYSA-N |
| SMILES | CC(=O)C(C(=O)NC1=CC=CC=C1OC)N=NC2=C(C=C(C=C2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)