CAS 1351556-84-7 is the registry number for 3-(2-(2-(2-(2-Azidoethoxy)ethoxy)ethoxy)ethoxy)-2-nitropyridine, 95%. Offered by: Ambeed. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg.
3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]-2-nitropyridine (CAS 1351556-84-7) is a chemical compound with the molecular formula C13H19N5O6 and a molecular weight of 341.32 g/mol. IUPAC name: 3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]-2-nitropyridine. InChIKey: AQODXLWEOPYPHB-UHFFFAOYSA-N.
| Molecular formula | C13H19N5O6 |
|---|---|
| Molecular weight | 341.32 g/mol |
| IUPAC name | 3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]-2-nitropyridine |
| InChIKey | AQODXLWEOPYPHB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)[N+](=O)[O-])OCCOCCOCCOCCN=[N+]=[N-] |
Computed by PubChem (NCBI)