CAS 1351620-91-1 is the registry number for 3-((Amino(imino)methyl)amino)benzenesulfonamide methanesulfonate, 95%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
Methanesulfonic acid;2-(3-sulfamoylphenyl)guanidine (CAS 1351620-91-1) is a chemical compound with the molecular formula C8H14N4O5S2 and a molecular weight of 310.4 g/mol. IUPAC name: methanesulfonic acid;2-(3-sulfamoylphenyl)guanidine. InChIKey: OROWFRUORZGGKI-UHFFFAOYSA-N.
| Molecular formula | C8H14N4O5S2 |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | methanesulfonic acid;2-(3-sulfamoylphenyl)guanidine |
| InChIKey | OROWFRUORZGGKI-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)O.C1=CC(=CC(=C1)S(=O)(=O)N)N=C(N)N |
Computed by PubChem (NCBI)