CAS 1351632-54-6 is the registry number for N–Methyl–N–(4–(methylsulfonyl)–1,3–benzothiazol–2–yl)glycine. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
2-[methyl-(4-methylsulfonyl-1,3-benzothiazol-2-yl)amino]acetic acid (CAS 1351632-54-6) is a chemical compound with the molecular formula C11H12N2O4S2 and a molecular weight of 300.4 g/mol. IUPAC name: 2-[methyl-(4-methylsulfonyl-1,3-benzothiazol-2-yl)amino]acetic acid. InChIKey: VKEFLERFAUNWNL-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O4S2 |
|---|---|
| Molecular weight | 300.4 g/mol |
| IUPAC name | 2-[methyl-(4-methylsulfonyl-1,3-benzothiazol-2-yl)amino]acetic acid |
| InChIKey | VKEFLERFAUNWNL-UHFFFAOYSA-N |
| SMILES | CN(CC(=O)O)C1=NC2=C(S1)C=CC=C2S(=O)(=O)C |
Computed by PubChem (NCBI)