CAS 1351634-83-7 appears in our catalog under these names: 3,10-Dithia-5,12-diazatricyclo(7.3.0.0,2,6)dodeca-1,4,6,8,11-pentaen-4-amine, 3,10-dithia-5,12-diazatricyclo[7.3.0.0^{2,6}]dodeca-1(9),2(6),4,7,11-pentaen-4-amine, 97%, 97%. Offered by: Biosynth, Chemat. Available pack sizes: 100mg, 1g, 5g, 10g.
[1,3]thiazolo[5,4-e][1,3]benzothiazol-2-amine (CAS 1351634-83-7) is a chemical compound with the molecular formula C8H5N3S2 and a molecular weight of 207.3 g/mol. IUPAC name: [1,3]thiazolo[5,4-e][1,3]benzothiazol-2-amine. InChIKey: QKDFGBUSMQNQNA-UHFFFAOYSA-N.
| Molecular formula | C8H5N3S2 |
|---|---|
| Molecular weight | 207.3 g/mol |
| IUPAC name | [1,3]thiazolo[5,4-e][1,3]benzothiazol-2-amine |
| InChIKey | QKDFGBUSMQNQNA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C3=C1N=C(S3)N)N=CS2 |
Computed by PubChem (NCBI)