CAS 1351804-44-8 is the registry number for N-(4-Fluorophenyl)-1-(4-nitrobenzyl)-1h-imidazole-4-carboxamide, 90%. Offered by: Combi-blocks. Available pack sizes: 100mg.
N-(4-fluorophenyl)-1-[(4-nitrophenyl)methyl]imidazole-4-carboxamide (CAS 1351804-44-8) is a chemical compound with the molecular formula C17H13FN4O3 and a molecular weight of 340.31 g/mol. IUPAC name: N-(4-fluorophenyl)-1-[(4-nitrophenyl)methyl]imidazole-4-carboxamide. InChIKey: SGERASCEHNOPCX-UHFFFAOYSA-N.
| Molecular formula | C17H13FN4O3 |
|---|---|
| Molecular weight | 340.31 g/mol |
| IUPAC name | N-(4-fluorophenyl)-1-[(4-nitrophenyl)methyl]imidazole-4-carboxamide |
| InChIKey | SGERASCEHNOPCX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C=C(N=C2)C(=O)NC3=CC=C(C=C3)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)