CAS 1351809-65-8 is the registry number for 1-(4-Aminobenzyl)-n-(3-methylphenyl)-1h-imidazole-4-carboxamide, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-[(4-aminophenyl)methyl]-N-(3-methylphenyl)imidazole-4-carboxamide (CAS 1351809-65-8) is a chemical compound with the molecular formula C18H18N4O and a molecular weight of 306.4 g/mol. IUPAC name: 1-[(4-aminophenyl)methyl]-N-(3-methylphenyl)imidazole-4-carboxamide. InChIKey: IAPGCKOZBGGGQD-UHFFFAOYSA-N.
| Molecular formula | C18H18N4O |
|---|---|
| Molecular weight | 306.4 g/mol |
| IUPAC name | 1-[(4-aminophenyl)methyl]-N-(3-methylphenyl)imidazole-4-carboxamide |
| InChIKey | IAPGCKOZBGGGQD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)NC(=O)C2=CN(C=N2)CC3=CC=C(C=C3)N |
Computed by PubChem (NCBI)